dimethyl 2-[(2-chlorophenyl)methyl]propanedioate structure
|
Common Name | dimethyl 2-[(2-chlorophenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 670748-78-4 | Molecular Weight | 256.68200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-[(2-chlorophenyl)methyl]propanedioate |
|---|
| Molecular Formula | C12H13ClO4 |
|---|---|
| Molecular Weight | 256.68200 |
| Exact Mass | 256.05000 |
| PSA | 52.60000 |
| LogP | 1.84470 |
| InChIKey | IDXPEJIDOVTQDN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccccc1Cl)C(=O)OC |
|
~84%
dimethyl 2-[(2-... CAS#:670748-78-4 |
| Literature: Takuwa, Tomofumi; Minowa, Tomofumi; Fujisawa, Hidehiko; Mukaiyama, Teruaki Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 5 p. 476 - 480 |
|
~%
dimethyl 2-[(2-... CAS#:670748-78-4 |
| Literature: Barnes; Gordon Journal of the American Chemical Society, 1949 , vol. 71, p. 2644,2646 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |