8-bromo-2-phenyl-3,1-benzoxazin-4-one
8-bromo-2-phenyl-3,1-benzoxazin-4-one structure
|
Common Name | 8-bromo-2-phenyl-3,1-benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 67090-35-1 | Molecular Weight | 302.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 8-Bromo-2-phenyl-3,1-benzoxazin-4-one (CAS: 67090-35-1), molecular formula C14H8BrNO2, molecular weight 302.12300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-bromo-2-phenyl-3,1-benzoxazin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8BrNO2 |
|---|---|
| Molecular Weight | 302.12300 |
| Exact Mass | 300.97400 |
| PSA | 43.10000 |
| LogP | 3.61750 |
| InChIKey | GISMEQMQTWUQLX-UHFFFAOYSA-N |
| SMILES | O=c1oc(-c2ccccc2)nc2c(Br)cccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
8-bromo-2-pheny... CAS#:67090-35-1 |
| Literature: Tiwari; Zaidi; Satsangi Die Pharmazie, 1980 , vol. 35, # 2 p. 73 - 75 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:89258-54-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-benzyl 8-bromo benzoxazinone |
| 4H-3,1-Benzoxazin-4-one,8-bromo-2-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 67090-35-1? |
| A: Chinese name of 67090-35-1 is 67090-35-1. |
| Q: What is the molecular weight of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: Molecular weight of 8-bromo-2-phenyl-3,1-benzoxazin-4-one is 302.12300. |
| Q: What is the LogP of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: LogP of 8-bromo-2-phenyl-3,1-benzoxazin-4-one is 3.61750. |
| Q: What is the English name of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: The English name of 8-bromo-2-phenyl-3,1-benzoxazin-4-one is 8-bromo-2-phenyl-3,1-benzoxazin-4-one. |
| Q: What are the downstream products of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: Related downstream products(CAS) of 8-bromo-2-phenyl-3,1-benzoxazin-4-one: 89258-54-8. |
| Q: What is the SMILES notation of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: SMILES notation of 8-bromo-2-phenyl-3,1-benzoxazin-4-one is O=c1oc(-c2ccccc2)nc2c(Br)cccc12. |
| Q: What are the upstream materials of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: Related upstream materials(CAS) of 8-bromo-2-phenyl-3,1-benzoxazin-4-one: 20776-51-6;98-88-4. |
| Q: What is the InChIKey of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: InChIKey of 8-bromo-2-phenyl-3,1-benzoxazin-4-one is GISMEQMQTWUQLX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: Molecular formula of 8-bromo-2-phenyl-3,1-benzoxazin-4-one is C14H8BrNO2. |
| Q: What is the polar surface area (PSA) of 8-bromo-2-phenyl-3,1-benzoxazin-4-one? |
| A: Polar surface area (PSA) of 8-bromo-2-phenyl-3,1-benzoxazin-4-one is 43.10000. |