Methyl 4-(acetoacetylaMino)benzenecarboxylate structure
|
Common Name | Methyl 4-(acetoacetylaMino)benzenecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 67093-75-8 | Molecular Weight | 235.23600 | |
| Density | 1.234g/cm3 | Boiling Point | 442.9ºC at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | 122-124ºC | |
| MSDS | N/A | Flash Point | 221.7ºC | |
| Name | methyl 4-(3-oxobutanoylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 442.9ºC at 760 mmHg |
| Melting Point | 122-124ºC |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 221.7ºC |
| Exact Mass | 235.08400 |
| PSA | 72.47000 |
| LogP | 1.46380 |
| Index of Refraction | 1.559 |
| InChIKey | RRXPQXHSMOPJLH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NC(=O)CC(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
|
~61%
Methyl 4-(aceto... CAS#:67093-75-8 |
| Literature: Synthesis, , # 6 art. no. T51110SS, p. 934 - 942 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetessigsaeure-(4-carbomethoxy-anilid) |
| N-(4-methoxycarbonyl)phenyl-3-oxobutanamide |
| methyl 4-(acetoacetylamino)benzoate |
| 4-Acetoacetylamino-benzoesaeure-methylester |
| methyl 4-(3-oxobutanamido)benzoate |
| methyl 4-(acetoacetylamino)benzenecarboxylate |
| 4-acetoacetylamino-benzoic acid methyl ester |