(1,3-dibromo-3,3-difluoropropyl)-trimethylsilane structure
|
Common Name | (1,3-dibromo-3,3-difluoropropyl)-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 671-80-7 | Molecular Weight | 310.05000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12Br2F2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1,3-dibromo-3,3-difluoropropyl)-trimethylsilane |
|---|
| Molecular Formula | C6H12Br2F2Si |
|---|---|
| Molecular Weight | 310.05000 |
| Exact Mass | 307.90400 |
| LogP | 4.42500 |
| InChIKey | WPVKWRQSUUCYNS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(Br)CC(F)(F)Br |
|
~57%
(1,3-dibromo-3,... CAS#:671-80-7 |
| Literature: Gonzales, Javier; Foti, Christopher J.; Elsheimer, Seth Journal of Organic Chemistry, 1991 , vol. 56, # 13 p. 4322 - 4325 |
|
~%
(1,3-dibromo-3,... CAS#:671-80-7 |
| Literature: Geyer et al. Journal of the Chemical Society, 1957 , p. 4472,4479 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |