H-Ala-Ala-Tyr-OH structure
|
Common Name | H-Ala-Ala-Tyr-OH | ||
|---|---|---|---|---|
| CAS Number | 67131-52-6 | Molecular Weight | 323.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Ala-Ala-Tyr-OHH-Ala-Ala-Tyr-OH can be synthesized mutant peptides[1][2]. |
| Name | H-Ala-Ala-Tyr-OH |
|---|
| Description | H-Ala-Ala-Tyr-OH can be synthesized mutant peptides[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H21N3O5 |
|---|---|
| Molecular Weight | 323.34400 |
| Exact Mass | 323.14800 |
| PSA | 141.75000 |
| LogP | 0.83810 |
| InChIKey | UGLPMYSCWHTZQU-AUTRQRHGSA-N |
| SMILES | CC(N)C(=O)NC(C)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |