Ethanone,2-bromo-1-(2,3,5,6-tetramethylphenyl) structure
|
Common Name | Ethanone,2-bromo-1-(2,3,5,6-tetramethylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 67159-34-6 | Molecular Weight | 255.15100 | |
| Density | 1.28g/cm3 | Boiling Point | 326.7ºC at 760 mmHg | |
| Molecular Formula | C12H15BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 51.5ºC | |
| Name | 2-bromo-1-(2,3,5,6-tetramethylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 326.7ºC at 760 mmHg |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15100 |
| Flash Point | 51.5ºC |
| Exact Mass | 254.03100 |
| PSA | 17.07000 |
| LogP | 3.49780 |
| Index of Refraction | 1.548 |
| InChIKey | BVSSCUABQUBAHU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C)c(C(=O)CBr)c1C |
|
~%
Ethanone,2-brom... CAS#:67159-34-6 |
| Literature: Fuson; Bannister Journal of the American Chemical Society, 1952 , vol. 74, p. 1629 |
|
~%
Ethanone,2-brom... CAS#:67159-34-6 |
| Literature: Hori, Mikio; Kataoka, Tadashi; Shimizu, Hiroshi; Imai, Eiji; Matsumoto, Yukiharu; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1211 - 1220 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3,5,6-tetramethylphenacyl bromide |
| 3-bromoacetyl-durene |