4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride
Modify Date: 2026-09-17 08:48:44
4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride structure
|
Common Name | 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 67159-83-5 | Molecular Weight | 275.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12BrClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12BrClO |
|---|---|
| Molecular Weight | 275.57 |
| InChIKey | IUIGGBWQIDOOKY-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)Cl)c1ccc(Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride? |
| A: SMILES notation of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride is CC(C)(CC(=O)Cl)c1ccc(Br)cc1. |
| Q: What is the Chinese name of 67159-83-5? |
| A: Chinese name of 67159-83-5 is 67159-83-5. |
| Q: What is the molecular formula of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride? |
| A: Molecular formula of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride is C11H12BrClO. |
| Q: What is the molecular weight of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride? |
| A: Molecular weight of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride is 275.57. |
| Q: What is the CAS number of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride? |
| A: CAS number of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride is 67159-83-5. |
| Q: What is the English name of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride? |
| A: The English name of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride is 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride. |
| Q: What is the InChIKey of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride? |
| A: InChIKey of 4-Bromo-I(2),I(2)-dimethylbenzenepropanoyl chloride is IUIGGBWQIDOOKY-UHFFFAOYSA-N. |