7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one
Modify Date: 2026-08-26 21:22:23
7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one structure
|
Common Name | 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 67159-86-8 | Molecular Weight | 239.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11BrO |
|---|---|
| Molecular Weight | 239.11 |
| InChIKey | JNOIFTAFZPMNGC-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2c(Br)cccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one? |
| A: CAS number of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one is 67159-86-8. |
| Q: What is the molecular formula of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one? |
| A: Molecular formula of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one is C11H11BrO. |
| Q: What is the Chinese name of 67159-86-8? |
| A: Chinese name of 67159-86-8 is 67159-86-8. |
| Q: What is the molecular weight of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one? |
| A: Molecular weight of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one is 239.11. |
| Q: What is the English name of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one? |
| A: The English name of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one is 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one. |
| Q: What is the InChIKey of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one? |
| A: InChIKey of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one is JNOIFTAFZPMNGC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one? |
| A: SMILES notation of 7-bromo-3,3-dimethyl-2,3-dihydro-1H-inden-1-one is CC1(C)CC(=O)c2c(Br)cccc21. |