3-(2,4-dibromophenyl)-1,2,3-benzotriazin-4-one structure
|
Common Name | 3-(2,4-dibromophenyl)-1,2,3-benzotriazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 67170-68-7 | Molecular Weight | 381.02200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Br2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,4-dibromophenyl)-1,2,3-benzotriazin-4-one |
|---|
| Molecular Formula | C13H7Br2N3O |
|---|---|
| Molecular Weight | 381.02200 |
| Exact Mass | 378.89600 |
| PSA | 47.78000 |
| LogP | 3.30570 |
| InChIKey | GKFZUERYRIWQPV-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nnn1-c1ccc(Br)cc1Br |
|
~%
3-(2,4-dibromop... CAS#:67170-68-7 |
| Literature: Chattaway; Walker Journal of the Chemical Society, 1927 , p. 329 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |