Propanamide,N-[2-(3,4-dimethoxyphenyl)ethyl]- structure
|
Common Name | Propanamide,N-[2-(3,4-dimethoxyphenyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 67191-53-1 | Molecular Weight | 237.29500 | |
| Density | 1.051g/cm3 | Boiling Point | 418.8ºC at 760 mmHg | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 207.1ºC | |
| Name | Buttersaeure-homoveratrylamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 418.8ºC at 760 mmHg |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29500 |
| Flash Point | 207.1ºC |
| Exact Mass | 237.13600 |
| PSA | 47.56000 |
| LogP | 2.16340 |
| Index of Refraction | 1.502 |
| InChIKey | SHEZBAGBVPEOSK-UHFFFAOYSA-N |
| SMILES | CCC(=O)NCCc1ccc(OC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-Dimethyl-1-(2-piperazinoethyl)-pyrrol |
| N-[2-(3,4-dimethoxyphenyl)-ethyl]-butanamide |
| 3,4-dimethoxyphenethyl propionylamide |
| N-<2-(3,4-dimethoxyphenyl)ethyl>propionamide |
| N-(3,4-dimethoxy-phenethyl)-propionamide |
| 1-[2-(2,5-dimethyl-1H-pyrrol-1-yl)ethyl]piperazine |
| N-(3,4-Dimethoxy-phenaethyl)-propionamid |
| [2-(2,5-dimethylpyrrolyl)ethyl]piperazine |
| N-(3,4-dimethoxy-phenethyl)-butyramide |
| 1-[2-(2,5-Dimethyl-pyrrol-1-yl)-ethyl]-piperazine |
| N-(3,4-Dimethoxy-phenaethyl)-butyramid |
| N-propionylhomoveratrylamine |