2-Butenedioicacid, 2-bromo-, dipropyl ester, (Z)- (9CI) structure
|
Common Name | 2-Butenedioicacid, 2-bromo-, dipropyl ester, (Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 67191-72-4 | Molecular Weight | 279.12800 | |
| Density | 1.347g/cm3 | Boiling Point | 301.8ºC at 760mmHg | |
| Molecular Formula | C10H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.3ºC | |
| Name | dipropyl (Z)-2-bromobut-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 301.8ºC at 760mmHg |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.12800 |
| Flash Point | 136.3ºC |
| Exact Mass | 278.01500 |
| PSA | 52.60000 |
| LogP | 2.17160 |
| Index of Refraction | 1.486 |
| InChIKey | MVUWHBQKBOIHDL-FPLPWBNLSA-N |
| SMILES | CCCOC(=O)C=C(Br)C(=O)OCCC |
|
~%
2-Butenedioicac... CAS#:67191-72-4 |
| Literature: Gershon; Shanks Journal of Pharmaceutical Sciences, 1978 , vol. 67, # 4 p. 578 - 580 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bromfumarsaeure-di-n-propylester |
| n-Propyl-bromfumarat |