2-Butenedioic acid,2-bromo-, dibutyl ester, (Z)- (9CI) structure
|
Common Name | 2-Butenedioic acid,2-bromo-, dibutyl ester, (Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 67191-73-5 | Molecular Weight | 307.18100 | |
| Density | 1.278g/cm3 | Boiling Point | 334.2ºC at 760mmHg | |
| Molecular Formula | C12H19BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.9ºC | |
| Name | dibutyl (Z)-2-bromobut-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 334.2ºC at 760mmHg |
| Molecular Formula | C12H19BrO4 |
| Molecular Weight | 307.18100 |
| Flash Point | 155.9ºC |
| Exact Mass | 306.04700 |
| PSA | 52.60000 |
| LogP | 2.95180 |
| Index of Refraction | 1.484 |
| InChIKey | PFIRCBPDYRFHNA-KTKRTIGZSA-N |
| SMILES | CCCCOC(=O)C=C(Br)C(=O)OCCCC |
|
~%
2-Butenedioic a... CAS#:67191-73-5 |
| Literature: Gershon; Shanks Journal of Pharmaceutical Sciences, 1978 , vol. 67, # 4 p. 578 - 580 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bromo-fumaric acid dibutyl ester |
| n-Butyl-bromfumarat |
| Brom-fumarsaeure-dibutylester |