dibutyl (Z)-2-iodobut-2-enedioate
dibutyl (Z)-2-iodobut-2-enedioate structure
|
Common Name | dibutyl (Z)-2-iodobut-2-enedioate | ||
|---|---|---|---|---|
| CAS Number | 67191-75-7 | Molecular Weight | 354.18100 | |
| Density | 1.44g/cm3 | Boiling Point | 359.7ºC at 760 mmHg | |
| Molecular Formula | C12H19IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
Summary: Dibutyl (Z)-2-iodobut-2-enedioate, Chinese name is dibutyl (Z)-2-碘丁-2-烯二酸酯, CAS number is 67191-75-7, molecular formula is C12H19IO4. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dibutyl (Z)-2-iodobut-2-enedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760 mmHg |
| Molecular Formula | C12H19IO4 |
| Molecular Weight | 354.18100 |
| Flash Point | 171.3ºC |
| Exact Mass | 354.03300 |
| PSA | 52.60000 |
| LogP | 2.99190 |
| Index of Refraction | 1.514 |
| InChIKey | KMICEZNUDDYZII-KTKRTIGZSA-N |
| SMILES | CCCCOC(=O)C=C(I)C(=O)OCCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
dibutyl (Z)-2-i... CAS#:67191-75-7 |
| Literature: Gershon; Shanks Journal of Pharmaceutical Sciences, 1978 , vol. 67, # 4 p. 578 - 580 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| n-Butyl-jodfumarat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: Boiling point of dibutyl (Z)-2-iodobut-2-enedioate is 359.7ºC at 760 mmHg. |
| Q: What is the English name of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: The English name of dibutyl (Z)-2-iodobut-2-enedioate is dibutyl (Z)-2-iodobut-2-enedioate. |
| Q: What is the polar surface area (PSA) of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: Polar surface area (PSA) of dibutyl (Z)-2-iodobut-2-enedioate is 52.60000. |
| Q: What are the upstream materials of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: Related upstream materials(CAS) of dibutyl (Z)-2-iodobut-2-enedioate: 5029-68-5;71-36-3. |
| Q: What English synonyms does dibutyl (Z)-2-iodobut-2-enedioate have? |
| A: English synonyms of dibutyl (Z)-2-iodobut-2-enedioate: n-Butyl-jodfumarat. |
| Q: What is the CAS number of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: CAS number of dibutyl (Z)-2-iodobut-2-enedioate is 67191-75-7. |
| Q: What is the LogP of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: LogP of dibutyl (Z)-2-iodobut-2-enedioate is 2.99190. |
| Q: What is the Chinese name of 67191-75-7? |
| A: Chinese name of 67191-75-7 is 67191-75-7. |
| Q: What is the SMILES notation of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: SMILES notation of dibutyl (Z)-2-iodobut-2-enedioate is CCCCOC(=O)C=C(I)C(=O)OCCCC. |
| Q: What is the molecular weight of dibutyl (Z)-2-iodobut-2-enedioate? |
| A: Molecular weight of dibutyl (Z)-2-iodobut-2-enedioate is 354.18100. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |