Ethanol, 2-[ (1-methylheptyl)amino]-, phenylcarbamate (ester), monohydrochloride structure
|
Common Name | Ethanol, 2-[ (1-methylheptyl)amino]-, phenylcarbamate (ester), monohydrochloride | ||
|---|---|---|---|---|
| CAS Number | 67196-00-3 | Molecular Weight | 328.87700 | |
| Density | 1.02g/cm3 | Boiling Point | 376ºC at 760 mmHg | |
| Molecular Formula | C17H29ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | Carbanilic acid, 2-[(1-methylheptyl)amino]ethyl ester, hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 376ºC at 760 mmHg |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.87700 |
| Flash Point | 181.2ºC |
| Exact Mass | 328.19200 |
| PSA | 50.36000 |
| LogP | 5.44950 |
| Index of Refraction | 1.522 |
| InChIKey | ZINRTEHIUIBFSI-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)[NH2+]CCOC(=O)Nc1ccccc1.[Cl-] |
|
~%
Ethanol, 2-[ (1... CAS#:67196-00-3 |
| Literature: Cope; Hancock Journal of the American Chemical Society, 1944 , vol. 66, p. 1448,1449, 1451 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| isopropyl p-nitrophenyl sulfide |
| 2-propyl 4-nitrophenyl sulfide |
| isopropyl 4-nitrophenyl sulfide |