1-Propen-2-ol,3,3,3-trifluoro-1-phenyl-, 2-benzoate structure
|
Common Name | 1-Propen-2-ol,3,3,3-trifluoro-1-phenyl-, 2-benzoate | ||
|---|---|---|---|---|
| CAS Number | 672-49-1 | Molecular Weight | 292.25300 | |
| Density | 1.276g/cm3 | Boiling Point | 373.6ºC at 760mmHg | |
| Molecular Formula | C16H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7ºC | |
| Name | (3,3,3-trifluoro-1-phenylprop-1-en-2-yl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 373.6ºC at 760mmHg |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.25300 |
| Flash Point | 155.7ºC |
| Exact Mass | 292.07100 |
| PSA | 26.30000 |
| LogP | 4.44680 |
| Index of Refraction | 1.557 |
| InChIKey | WDBHYWQLMJOLRO-SDNWHVSQSA-N |
| SMILES | O=C(OC(=Cc1ccccc1)C(F)(F)F)c1ccccc1 |
|
~%
1-Propen-2-ol,3... CAS#:672-49-1 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1953 , vol. 75, p. 2059,2061 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoesaeure-(2-nitro-propylester) |
| benzoic acid-(2-nitro-propyl ester) |
| benzoic acid-(2-phenyl-1-trifluoromethyl-vinyl ester) |
| Benzoesaeure-(2-phenyl-1-trifluormethyl-vinylester) |
| 1-Propanol,2-nitro-,1-benzoate |