(4-but-2-enyl-2-methyl-3-oxocyclopenten-1-yl) acetate structure
|
Common Name | (4-but-2-enyl-2-methyl-3-oxocyclopenten-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 67220-81-9 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-but-2-enyl-2-methyl-3-oxocyclopenten-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 43.37000 |
| LogP | 2.37870 |
| InChIKey | FMIBJICONRHRTM-UHFFFAOYSA-N |
| SMILES | CC=CCC1CC(OC(C)=O)=C(C)C1=O |
|
~%
(4-but-2-enyl-2... CAS#:67220-81-9 |
| Literature: Barker, Andrew J.; Pattenden, Gerald Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1885 - 1891 |
|
~%
(4-but-2-enyl-2... CAS#:67220-81-9 |
| Literature: Barker, Andrew J.; Pattenden, Gerald Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1885 - 1891 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-acetoxy-5-but-2-enyl-2-methylcyclopent-2-en-1-one |