1-Dimethylamino-3-phenyl-4-hexanone structure
|
Common Name | 1-Dimethylamino-3-phenyl-4-hexanone | ||
|---|---|---|---|---|
| CAS Number | 67227-14-9 | Molecular Weight | 219.32300 | |
| Density | 0.968g/cm3 | Boiling Point | 312.9ºC at 760 mmHg | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.8ºC | |
| Name | 6-(dimethylamino)-4-phenylhexan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.968g/cm3 |
|---|---|
| Boiling Point | 312.9ºC at 760 mmHg |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.32300 |
| Flash Point | 90.8ºC |
| Exact Mass | 219.16200 |
| PSA | 20.31000 |
| LogP | 2.70100 |
| Index of Refraction | 1.506 |
| InChIKey | ZFQTWPRJPYNFEC-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(CCN(C)C)c1ccccc1 |
|
~%
1-Dimethylamino... CAS#:67227-14-9 |
| Literature: Blicke; Tsao Journal of the American Chemical Society, 1953 , vol. 75, p. 5587,5589 |
| 1-Dimethylamino-3-phenyl-4-hexanone |
| 4-HEXANONE,1-DIMETHYLAMINO-3-PHENYL |
| 6-dimethylamino-4-phenyl-hexan-3-one |