3-(2-methylpiperidin-1-yl)propyl furan-2-carboxylate,hydrochloride structure
|
Common Name | 3-(2-methylpiperidin-1-yl)propyl furan-2-carboxylate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 67227-32-1 | Molecular Weight | 287.78200 | |
| Density | N/A | Boiling Point | 352ºC at 760 mmHg | |
| Molecular Formula | C14H22ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.7ºC | |
| Name | 3-(2-methylpiperidin-1-yl)propyl furan-2-carboxylate,hydrochloride |
|---|
| Boiling Point | 352ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.78200 |
| Flash Point | 166.7ºC |
| Exact Mass | 287.12900 |
| PSA | 42.68000 |
| LogP | 3.44080 |
| InChIKey | KXLWFNYPHDJYSH-UHFFFAOYSA-N |
| SMILES | CC1CCCCN1CCCOC(=O)c1ccco1.Cl |
|
~%
3-(2-methylpipe... CAS#:67227-32-1 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |