Fluoren-2-amine (8CI), N,N-bis(2-chloropropyl)- structure
|
Common Name | Fluoren-2-amine (8CI), N,N-bis(2-chloropropyl)- | ||
|---|---|---|---|---|
| CAS Number | 6723-17-7 | Molecular Weight | 334.28300 | |
| Density | 1.211g/cm3 | Boiling Point | 479.6ºC at 760 mmHg | |
| Molecular Formula | C19H21Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.8ºC | |
| Name | Fluoren-2-amine (8CI), N,N-bis(2-chloropropyl) |
|---|
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 479.6ºC at 760 mmHg |
| Molecular Formula | C19H21Cl2N |
| Molecular Weight | 334.28300 |
| Flash Point | 243.8ºC |
| Exact Mass | 333.10500 |
| PSA | 3.24000 |
| LogP | 5.31880 |
| Index of Refraction | 1.614 |
| InChIKey | OPTJDBUDUXVZBP-UHFFFAOYSA-N |
| SMILES | CC(Cl)CN(CC(C)Cl)c1ccc2c(c1)Cc1ccccc1-2 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |