N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide
![N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide Structure](https://image.chemsrc.com/caspic/390/67237-63-2.png)
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide structure
|
Common Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 67237-63-2 | Molecular Weight | 329.39000 | |
| Density | 1.12g/cm3 | Boiling Point | 541.3ºC at 760 mmHg | |
| Molecular Formula | C19H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 541.3ºC at 760 mmHg |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.39000 |
| Flash Point | 281.2ºC |
| Exact Mass | 329.16300 |
| PSA | 56.79000 |
| LogP | 3.00470 |
| Index of Refraction | 1.547 |
| InChIKey | JXUNQKVJRZBSER-UHFFFAOYSA-N |
| SMILES | COc1cccc(CC(=O)NCCc2ccc(OC)c(OC)c2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: InChIKey of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is JXUNQKVJRZBSER-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: Polar surface area (PSA) of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is 56.79000. |
| Q: What is the molecular formula of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: Molecular formula of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is C19H23NO4. |
| Q: What is the LogP of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: LogP of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is 3.00470. |
| Q: What is the molecular weight of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: Molecular weight of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is 329.39000. |
| Q: What is the SMILES notation of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: SMILES notation of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is COc1cccc(CC(=O)NCCc2ccc(OC)c(OC)c2)c1. |
| Q: What is the boiling point of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: Boiling point of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is 541.3ºC at 760 mmHg. |
| Q: What are the upstream materials of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: Related upstream materials(CAS) of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide: 120-20-7;6834-42-0;1798-09-0;4230-93-7;120-14-9. |
| Q: What is the English name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: The English name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide. |
| Q: What is the CAS number of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide? |
| A: CAS number of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide is 67237-63-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |