2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile
Modify Date: 2025-08-29 20:40:38
![2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile Structure](https://www.chemsrc.com/extcaspic/031/67237-77-8.png)
2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile structure
|
Common Name | 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 67237-77-8 | Molecular Weight | 299.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14ClNO2 |
|---|---|
| Molecular Weight | 299.7 |
| InChIKey | PZQPNSIULTZBAH-UHFFFAOYSA-N |
| SMILES | N#Cc1ccccc1CC1(c2ccc(Cl)cc2)OCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile? |
| A: Molecular weight of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile is 299.7. |
| Q: What is the InChIKey of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile? |
| A: InChIKey of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile is PZQPNSIULTZBAH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile? |
| A: SMILES notation of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile is N#Cc1ccccc1CC1(c2ccc(Cl)cc2)OCCO1. |
| Q: What is the molecular formula of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile? |
| A: Molecular formula of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile is C17H14ClNO2. |
| Q: What is the English name of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile? |
| A: The English name of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile is 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile. |
| Q: What is the CAS number of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile? |
| A: CAS number of 2-[[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]methyl]benzonitrile is 67237-77-8. |
| Q: What is the Chinese name of 67237-77-8? |
| A: Chinese name of 67237-77-8 is 67237-77-8. |