4-methyl-7-prop-2-ynoxychromen-2-one structure
|
Common Name | 4-methyl-7-prop-2-ynoxychromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 67268-43-3 | Molecular Weight | 214.21700 | |
| Density | 1.218g/cm3 | Boiling Point | 386.6ºC at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 4-methyl-7-prop-2-ynoxychromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760 mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 162.8ºC |
| Exact Mass | 214.06300 |
| PSA | 39.44000 |
| LogP | 2.11340 |
| Index of Refraction | 1.576 |
| InChIKey | NTNZDKLXIBVSQQ-UHFFFAOYSA-N |
| SMILES | C#CCOc1ccc2c(C)cc(=O)oc2c1 |
|
~95%
4-methyl-7-prop... CAS#:67268-43-3 |
| Literature: Rao, Ch Prasad; Krupadanam, G L David; Srimannarayana G Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 7 p. 666 - 671 |
|
~%
Detail
|
| Literature: Unicler Patent: US4151291 A1, 1979 ; |
|
~%
4-methyl-7-prop... CAS#:67268-43-3 |
| Literature: Naik, Reshma J.; Kulkarni, Manohar V.; Sreedhara Ranganath Pai; Nayak, Pawan G. Chemical Biology and Drug Design, 2012 , vol. 80, # 4 p. 516 - 523 |
| 4-methyl-7-propargyloxycumarin |
| Giparmen |
| Giparmene |
| 7-propargyloxy-4-methyl-2H-chromen-2-one |