Benzamide,4-ethoxy-N,N-diethyl- structure
|
Common Name | Benzamide,4-ethoxy-N,N-diethyl- | ||
|---|---|---|---|---|
| CAS Number | 67272-97-3 | Molecular Weight | 221.29500 | |
| Density | 1.013g/cm3 | Boiling Point | 357ºC at 760mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 4-Ethoxy-N,N-diethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 169.7ºC |
| Exact Mass | 221.14200 |
| PSA | 29.54000 |
| LogP | 2.56730 |
| Index of Refraction | 1.509 |
| InChIKey | BNKLTZHPOPBYQP-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)N(CC)CC)cc1 |
|
~%
Benzamide,4-eth... CAS#:67272-97-3 |
| Literature: Lubbert, Hermann; Ullmer, Christoph; Bellott, Emile; Froimowitz, Mark; Gordon, Douglas Patent: US2003/166672 A1, 2003 ; US 20030166672 A1 |
|
~%
Benzamide,4-eth... CAS#:67272-97-3 |
| Literature: McCabe et al. Journal of Organic Chemistry, 1954 , vol. 19, p. 493,496 |
| Benzamide,4-ethoxy-N,N-diethyl |
| 4-Aethoxy-benzoesaeure-diaethylamid |
| Benzamide,p-ethoxy-N,N-diethyl |
| 4-Ethoxy-Benzoic Acid-Diethylamide |