(+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine
Modify Date: 2026-09-15 09:35:04
(+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine structure
|
Common Name | (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine | ||
|---|---|---|---|---|
| CAS Number | 67289-14-9 | Molecular Weight | 334.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H18N4O2 |
|---|---|
| Molecular Weight | 334.4 |
| InChIKey | QAWNTPLHKRXYQD-UHFFFAOYSA-N |
| SMILES | Nc1nc(NC(Cc2ccccc2)c2ccccc2)ccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine? |
| A: The English name of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine is (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine. |
| Q: What is the InChIKey of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine? |
| A: InChIKey of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine is QAWNTPLHKRXYQD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine? |
| A: Molecular formula of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine is C19H18N4O2. |
| Q: What is the Chinese name of 67289-14-9? |
| A: Chinese name of 67289-14-9 is 67289-14-9. |
| Q: What is the CAS number of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine? |
| A: CAS number of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine is 67289-14-9. |
| Q: What is the molecular weight of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine? |
| A: Molecular weight of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine is 334.4. |
| Q: What is the SMILES notation of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine? |
| A: SMILES notation of (+)-N6-(1,2-Diphenylethyl)-3-nitro-2,6-pyridinediamine is Nc1nc(NC(Cc2ccccc2)c2ccccc2)ccc1[N+](=O)[O-]. |