2-(diethylamino)ethyl 2,3-dihydro-1H-indene-2-carboxylate,hydrochloride structure
|
Common Name | 2-(diethylamino)ethyl 2,3-dihydro-1H-indene-2-carboxylate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 67293-01-0 | Molecular Weight | 297.82000 | |
| Density | N/A | Boiling Point | 367.5ºC at 760 mmHg | |
| Molecular Formula | C16H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.2ºC | |
| Name | 2-(diethylamino)ethyl 2,3-dihydro-1H-indene-2-carboxylate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 367.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.82000 |
| Flash Point | 125.2ºC |
| Exact Mass | 297.15000 |
| PSA | 29.54000 |
| LogP | 3.08840 |
| InChIKey | FHPRYHJEAXCGEL-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C1Cc2ccccc2C1.Cl |
|
~%
2-(diethylamino... CAS#:67293-01-0 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 262,263 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-diethylaminoethyl 2,3-dihydro-1H-indene-2-carboxylate hydrochloride |