4-phenylmethoxycarbonylaminocyclohexane-1-carboxylic acid
Modify Date: 2025-10-27 21:18:26
4-phenylmethoxycarbonylaminocyclohexane-1-carboxylic acid structure
|
Common Name | 4-phenylmethoxycarbonylaminocyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 67299-52-9 | Molecular Weight | 277.31600 | |
| Density | 1.22g/cm3 | Boiling Point | 484.7ºC at 760 mmHg | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.9ºC | |
| Name | z-1,4-cis-achc-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 484.7ºC at 760 mmHg |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31600 |
| Flash Point | 246.9ºC |
| Exact Mass | 277.13100 |
| PSA | 75.63000 |
| LogP | 2.94710 |
| Index of Refraction | 1.565 |
| InChIKey | ZVMICQYOGWAOSU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| z-cis-4-aminocyclohexanecarboxylic acid |
| cis-4-benzyloxycarbonylaminocyclohexanecarboxylic acid |