trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol
trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol structure
|
Common Name | trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol | ||
|---|---|---|---|---|
| CAS Number | 673-13-2 | Molecular Weight | 312.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Cl2FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: trans-2',5'-Dichloro-3-fluoro-4-dimethylamino-azobenzol, CAS number 673-13-2, molecular formula C14H12Cl2FN3, molecular weight 312.17. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12Cl2FN3 |
|---|---|
| Molecular Weight | 312.17000 |
| Exact Mass | 311.03900 |
| PSA | 27.96000 |
| LogP | 5.61390 |
| InChIKey | WUZONMKNWGIZSR-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2cc(Cl)ccc2Cl)cc1F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:321-25-5
CAS#:3824-31-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: Related downstream products(CAS) of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol: 321-25-5;3824-31-5. |
| Q: What is the English name of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: The English name of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol. |
| Q: What is the LogP of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: LogP of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is 5.61390. |
| Q: What is the molecular formula of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: Molecular formula of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is C14H12Cl2FN3. |
| Q: What is the SMILES notation of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: SMILES notation of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is CN(C)c1ccc(N=Nc2cc(Cl)ccc2Cl)cc1F. |
| Q: What is the CAS number of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: CAS number of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is 673-13-2. |
| Q: What is the InChIKey of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: InChIKey of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is WUZONMKNWGIZSR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 673-13-2? |
| A: Chinese name of 673-13-2 is 673-13-2. |
| Q: What is the polar surface area (PSA) of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: Polar surface area (PSA) of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is 27.96000. |
| Q: What is the molecular weight of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol? |
| A: Molecular weight of trans-2',5'-Dichlor-3-fluor-4-dimethylamino-azobenzol is 312.17000. |