2,3,5-Trimethoxyamphetamine, (R)
Modify Date: 2025-10-01 16:01:32
2,3,5-Trimethoxyamphetamine, (R) structure
|
Common Name | 2,3,5-Trimethoxyamphetamine, (R) | ||
|---|---|---|---|---|
| CAS Number | 67313-95-5 | Molecular Weight | 225.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,5-Trimethoxyamphetamine, (R) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO3 |
|---|---|
| Molecular Weight | 225.28 |
| InChIKey | MJIBJXKJBRLSQA-MRVPVSSYSA-N |
| SMILES | COc1cc(CC(C)N)c(OC)c(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,3,5-Trimethoxyamphetamine, (R)? |
| A: Molecular formula of 2,3,5-Trimethoxyamphetamine, (R) is C12H19NO3. |
| Q: What is the SMILES notation of 2,3,5-Trimethoxyamphetamine, (R)? |
| A: SMILES notation of 2,3,5-Trimethoxyamphetamine, (R) is COc1cc(CC(C)N)c(OC)c(OC)c1. |
| Q: What is the molecular weight of 2,3,5-Trimethoxyamphetamine, (R)? |
| A: Molecular weight of 2,3,5-Trimethoxyamphetamine, (R) is 225.28. |
| Q: What is the English name of 2,3,5-Trimethoxyamphetamine, (R)? |
| A: The English name of 2,3,5-Trimethoxyamphetamine, (R) is 2,3,5-Trimethoxyamphetamine, (R). |
| Q: What is the CAS number of 2,3,5-Trimethoxyamphetamine, (R)? |
| A: CAS number of 2,3,5-Trimethoxyamphetamine, (R) is 67313-95-5. |
| Q: What is the InChIKey of 2,3,5-Trimethoxyamphetamine, (R)? |
| A: InChIKey of 2,3,5-Trimethoxyamphetamine, (R) is MJIBJXKJBRLSQA-MRVPVSSYSA-N. |
| Q: What is the Chinese name of 67313-95-5? |
| A: Chinese name of 67313-95-5 is 67313-95-5. |