3Z2Qnq7cxn
Modify Date: 2026-08-29 00:45:49
3Z2Qnq7cxn structure
|
Common Name | 3Z2Qnq7cxn | ||
|---|---|---|---|---|
| CAS Number | 67313-96-6 | Molecular Weight | 225.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3Z2Qnq7cxn |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO3 |
|---|---|
| Molecular Weight | 225.28 |
| InChIKey | OASZJWLOOFXASO-MRVPVSSYSA-N |
| SMILES | COc1ccc(OC)c(OC)c1CC(C)N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3Z2Qnq7cxn? |
| A: Molecular weight of 3Z2Qnq7cxn is 225.28. |
| Q: What is the molecular formula of 3Z2Qnq7cxn? |
| A: Molecular formula of 3Z2Qnq7cxn is C12H19NO3. |
| Q: What is the InChIKey of 3Z2Qnq7cxn? |
| A: InChIKey of 3Z2Qnq7cxn is OASZJWLOOFXASO-MRVPVSSYSA-N. |
| Q: What is the CAS number of 3Z2Qnq7cxn? |
| A: CAS number of 3Z2Qnq7cxn is 67313-96-6. |
| Q: What is the SMILES notation of 3Z2Qnq7cxn? |
| A: SMILES notation of 3Z2Qnq7cxn is COc1ccc(OC)c(OC)c1CC(C)N. |
| Q: What is the English name of 3Z2Qnq7cxn? |
| A: The English name of 3Z2Qnq7cxn is 3Z2Qnq7cxn. |
| Q: What is the Chinese name of 67313-96-6? |
| A: Chinese name of 67313-96-6 is 67313-96-6. |