tetrakis(2-methyl-1-phenylprop-1-enyl)stannane structure
|
Common Name | tetrakis(2-methyl-1-phenylprop-1-enyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 67344-08-5 | Molecular Weight | 643.47800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H44Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tetrakis(2-methyl-1-phenylprop-1-enyl)stannane |
|---|
| Molecular Formula | C40H44Sn |
|---|---|
| Molecular Weight | 643.47800 |
| Exact Mass | 644.24600 |
| LogP | 10.83560 |
| InChIKey | HNNUBQRCNRFACJ-UHFFFAOYSA-N |
| SMILES | CC(C)=C(c1ccccc1)[Sn](C(=C(C)C)c1ccccc1)(C(=C(C)C)c1ccccc1)C(=C(C)C)c1ccccc1 |
|
~15%
tetrakis(2-meth... CAS#:67344-08-5 |
| Literature: Cardin, Christine J.; Cardin, David J.; Kelly, John M.; Norton, Reginald J.; Roy, Abhijit; et al. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1983 , p. 671 - 678 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |