3-(5-methyl-1,2-oxazol-3-yl)-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one structure
|
Common Name | 3-(5-methyl-1,2-oxazol-3-yl)-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 673452-00-1 | Molecular Weight | 287.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(5-methyl-1,2-oxazol-3-yl)-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|
| Molecular Formula | C14H13N3O2S |
|---|---|
| Molecular Weight | 287.33700 |
| Exact Mass | 287.07300 |
| PSA | 84.00000 |
| LogP | 3.12390 |
| InChIKey | NQDCIKKVMYIAEM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C2SCC(=O)N2c2cc(C)on2)cc1 |
|
~75%
3-(5-methyl-1,2... CAS#:673452-00-1 |
| Literature: Rajanarendar; Raju; Reddy, A. Siva Rami Phosphorus, Sulfur and Silicon and the Related Elements, 2009 , vol. 184, # 12 p. 3139 - 3148 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |