2,7-Dibromo-9,9-bis[3-(dimethylamino)propyl]fluorene structure
|
Common Name | 2,7-Dibromo-9,9-bis[3-(dimethylamino)propyl]fluorene | ||
|---|---|---|---|---|
| CAS Number | 673474-73-2 | Molecular Weight | 494.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30Br2N2 | Melting Point | 76 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2,7-dibromo-9-[3-(dimethylamino)propyl]fluoren-9-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 76 °C |
|---|---|
| Molecular Formula | C23H30Br2N2 |
| Molecular Weight | 494.30600 |
| Exact Mass | 492.07800 |
| PSA | 6.48000 |
| LogP | 6.16170 |
| InChIKey | RJIWYGUYDXBQCJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(CCCN(C)C)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| HS Code | 2921499090 |
|---|
|
~49%
2,7-Dibromo-9,9... CAS#:673474-73-2 |
| Literature: Huang, Fei; Hou, Lintao; Shen, Huilin; Jiang, Jiaxing; Wang, Feng; Zhen, Hongyu; Cao, Yong Journal of Materials Chemistry, 2005 , vol. 15, # 25 p. 2499 - 2507 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD22988888 |