tetrabutylammonim salt of diethylphosphoric acid structure
|
Common Name | tetrabutylammonim salt of diethylphosphoric acid | ||
|---|---|---|---|---|
| CAS Number | 67353-83-7 | Molecular Weight | 227.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H22NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tetrabutylammonim salt of diethylphosphoric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H22NO4P |
|---|---|
| Molecular Weight | 227.23800 |
| Exact Mass | 227.12900 |
| PSA | 68.40000 |
| LogP | 1.92040 |
| InChIKey | NEHSAVWMNJBWQI-UHFFFAOYSA-M |
| SMILES | CCOP(=O)([O-])OCC.C[N+](C)(C)C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| tetramethylammonium diethylphosphate |
| Tetramethyl-ammonium, Diaethylphosphat |
| tetramethylammonium, diethyl phosphate |
| tetramethylammonium diethyl phosphate |