3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole
3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole structure
|
Common Name | 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 67370-48-3 | Molecular Weight | 399.61600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17NS4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H17NS4 |
|---|---|
| Molecular Weight | 399.61600 |
| Exact Mass | 399.02400 |
| PSA | 116.99000 |
| LogP | 7.42470 |
| InChIKey | PJFFOTSNMUPPDS-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(C)c(C2Sc3ccccc3S2)c1C1Sc2ccccc2S1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,4-bis(1,3-ben... CAS#:67370-48-3 |
| Literature: Nakayama,J. et al. Bulletin of the Chemical Society of Japan, 1978 , vol. 51, p. 1427 - 1432 |
|
~%
3,4-bis(1,3-ben... CAS#:67370-48-3 |
| Literature: Nakayama,J. et al. Bulletin of the Chemical Society of Japan, 1978 , vol. 51, p. 1427 - 1432 |
![3-benzo[1,3]dithiol-2-yl-2,5-dimethyl-pyrrole structure](https://image.chemsrc.com/caspic/402/58488-40-7.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: SMILES notation of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is Cc1[nH]c(C)c(C2Sc3ccccc3S2)c1C1Sc2ccccc2S1. |
| Q: What are the upstream materials of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: Related upstream materials(CAS) of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole: 625-84-3;55315-56-5;57842-27-0;58488-40-7. |
| Q: What is the molecular formula of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: Molecular formula of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is C20H17NS4. |
| Q: What is the English name of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: The English name of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole. |
| Q: What is the InChIKey of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: InChIKey of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is PJFFOTSNMUPPDS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: Molecular weight of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is 399.61600. |
| Q: What is the polar surface area (PSA) of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: Polar surface area (PSA) of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is 116.99000. |
| Q: What is the Chinese name of 67370-48-3? |
| A: Chinese name of 67370-48-3 is 67370-48-3. |
| Q: What is the LogP of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: LogP of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is 7.42470. |
| Q: What is the CAS number of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole? |
| A: CAS number of 3,4-bis(1,3-benzodithiol-2-yl)-2,5-dimethyl-1H-pyrrole is 67370-48-3. |