4-ethylidene-2,6-ditert-butyl-cyclohexa-2,5-dien-1-one structure
|
Common Name | 4-ethylidene-2,6-ditert-butyl-cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 6738-27-8 | Molecular Weight | 232.36100 | |
| Density | 0.987g/cm3 | Boiling Point | 324.8ºC at 760 mmHg | |
| Molecular Formula | C16H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.4ºC | |
| Name | 2,6-ditert-butyl-4-ethylidenecyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.987g/cm3 |
|---|---|
| Boiling Point | 324.8ºC at 760 mmHg |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.36100 |
| Flash Point | 134.4ºC |
| Exact Mass | 232.18300 |
| PSA | 17.07000 |
| LogP | 4.46040 |
| Index of Refraction | 1.544 |
| InChIKey | KEJPWCIDZLVYDJ-UHFFFAOYSA-N |
| SMILES | CC=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
|
~%
4-ethylidene-2,... CAS#:6738-27-8 |
| Literature: Cook; Norcross Journal of the American Chemical Society, 1959 , vol. 81, p. 1176,1178 |
|
~%
4-ethylidene-2,... CAS#:6738-27-8 |
| Literature: Roginskii, V. A. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1985 , vol. 34, p. 1833 - 1841 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1985 , # 9 p. 1987 - 1996 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2,6-di-tert-butyl-4-ethylidene |
| 4-ethylidene-2,6-di-tert-butyl-cyclohexa-2,5-dienone |
| 2,6-di-tert-butyl-4-ethylidenecyclohexa-2,5-en-1-one |
| 2,5-Cyclohexadien-1-one,2,6-di-tert-butyl-4-ethylidene |
| 2,6-di-tert-butyl-4-ethylidene-2,5-cyclohexadien-1-one |
| 4-Aethyliden-2,6-di-tert-butyl-cyclohexa-2,5-dienon |
| 2,1-dimethylethyl)-4-ethylidene-2,5-cyclohexadiene-1-one |
| 2,6-Di-tert-butyl-4-ethylene-2,5-cyclohexadiene-1-one |