1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one
![1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one Structure](https://image.chemsrc.com/caspic/125/67390-32-3.png)
1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one structure
|
Common Name | 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one | ||
|---|---|---|---|---|
| CAS Number | 67390-32-3 | Molecular Weight | 237.32100 | |
| Density | 1.51g/cm3 | Boiling Point | 430.3ºC at 760 mmHg | |
| Molecular Formula | C11H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 430.3ºC at 760 mmHg |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.32100 |
| Flash Point | 214ºC |
| Exact Mass | 237.09400 |
| PSA | 72.22000 |
| LogP | 1.02870 |
| Index of Refraction | 1.76 |
| InChIKey | FAILTMBJMVTSRG-UHFFFAOYSA-N |
| SMILES | O=c1c2c(nc3n1CCSCC3)NCCC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,2,3,4,7,8,10,... CAS#:67390-32-3 |
| Literature: Wamhoff,H.; Lichtenthaeler,L. Chemische Berichte, 1978 , vol. 111, p. 2297 - 2306 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,3,4,7,8,10,11-octahydro-pyrido[2',3':4,5]pyrimido[1,2-d][1,4]thiazepin-5-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one have? |
| A: English synonyms of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one: 1,2,3,4,7,8,10,11-octahydro-pyrido[2',3':4,5]pyrimido[1,2-d][1,4]thiazepin-5-one. |
| Q: What are the upstream materials of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: Related upstream materials(CAS) of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one: 10244-04-9;57012-45-0. |
| Q: What is the CAS number of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: CAS number of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one is 67390-32-3. |
| Q: What is the molecular weight of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: Molecular weight of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one is 237.32100. |
| Q: What is the LogP of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: LogP of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one is 1.02870. |
| Q: What is the molecular formula of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: Molecular formula of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one is C11H15N3OS. |
| Q: What is the English name of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: The English name of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one is 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one. |
| Q: What is the InChIKey of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: InChIKey of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one is FAILTMBJMVTSRG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 67390-32-3? |
| A: Chinese name of 67390-32-3 is 67390-32-3. |
| Q: What is the polar surface area (PSA) of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one? |
| A: Polar surface area (PSA) of 1,2,3,4,7,8,10,11-octahydropyrido[3,4]pyrimido[4,5-a][1,4]thiazepin-5-one is 72.22000. |