5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride
![5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride Structure](https://image.chemsrc.com/caspic/381/67446-83-7.png)
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride structure
|
Common Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 67446-83-7 | Molecular Weight | 380.10300 | |
| Density | 1.559g/cm3 | Boiling Point | 399.4ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl2F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.3ºC | |
Summary: 5-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride, Chinese name: 5-[2-氯-4-(三氟甲基)苯氧基]-2-硝基苯甲酰氯, CAS number: 67446-83-7, molecular formula: C14H6Cl2F3NO4, molecular weight: 380.10300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 399.4ºC at 760 mmHg |
| Molecular Formula | C14H6Cl2F3NO4 |
| Molecular Weight | 380.10300 |
| Flash Point | 195.3ºC |
| Exact Mass | 378.96300 |
| PSA | 72.12000 |
| LogP | 5.96150 |
| Index of Refraction | 1.564 |
| InChIKey | KGPHNHSAYAXSOW-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-[2-chloro-4-(... CAS#:67446-83-7 |
| Literature: Sandoz Ltd. Patent: US4618359 A1, 1986 ; |
|
~%
5-[2-chloro-4-(... CAS#:67446-83-7 |
| Literature: GAF Corporation Patent: US4568382 A1, 1986 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| einecs 266-694-4 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: Boiling point of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride is 399.4ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: Polar surface area (PSA) of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride is 72.12000. |
| Q: What is the LogP of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: LogP of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride is 5.96150. |
| Q: What is the SMILES notation of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: SMILES notation of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride is O=C(Cl)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-]. |
| Q: What is the Chinese name of 67446-83-7? |
| A: Chinese name of 67446-83-7 is 67446-83-7. |
| Q: What English synonyms does 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride have? |
| A: English synonyms of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride: einecs 266-694-4. |
| Q: What is the InChIKey of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: InChIKey of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride is KGPHNHSAYAXSOW-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: CAS number of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride is 67446-83-7. |
| Q: What are the upstream materials of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: Related upstream materials(CAS) of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride: 50594-66-6. |
| Q: What is the English name of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride? |
| A: The English name of 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl chloride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |