tetra-p-tolyltin structure
|
Common Name | tetra-p-tolyltin | ||
|---|---|---|---|---|
| CAS Number | 6746-22-1 | Molecular Weight | 483.22300 | |
| Density | N/A | Boiling Point | 517.9ºC at 760 mmHg | |
| Molecular Formula | C28H28Sn | Melting Point | 236-237ºC | |
| MSDS | N/A | Flash Point | 265.3ºC | |
| Name | tetra-p-tolyltin |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 517.9ºC at 760 mmHg |
|---|---|
| Melting Point | 236-237ºC |
| Molecular Formula | C28H28Sn |
| Molecular Weight | 483.22300 |
| Flash Point | 265.3ºC |
| Exact Mass | 484.12100 |
| LogP | 4.29760 |
| InChIKey | IYTDOHOTDDKRRS-UHFFFAOYSA-N |
| SMILES | Cc1ccc([Sn](c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| TETRA-4-TOLYLTIN |
| Tetra-p-tolytin |
| tetrakis-paramethylphenyltin |
| tetra-p-tolylstannane |