benzyl 2,4-dichlorobenzoate structure
|
Common Name | benzyl 2,4-dichlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 67460-11-1 | Molecular Weight | 281.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 2,4-dichlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10Cl2O2 |
|---|---|
| Molecular Weight | 281.13400 |
| Exact Mass | 280.00600 |
| PSA | 26.30000 |
| LogP | 4.35040 |
| InChIKey | VPRFLOOPCOGIJG-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)c1ccc(Cl)cc1Cl |
|
~91%
benzyl 2,4-dich... CAS#:67460-11-1 |
| Literature: Finney, Eric E.; Ogawa, Kelli A.; Boydston, Andrew J. Journal of the American Chemical Society, 2012 , vol. 134, # 30 p. 12374 - 12377 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,2,4-dichloro-,phenylmethyl ester |
| 2,4-Dichlorbenzoesaeure-benzylester |