acetic acid,6-iodo-1,3-benzodioxol-5-ol structure
|
Common Name | acetic acid,6-iodo-1,3-benzodioxol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 67467-12-3 | Molecular Weight | 324.06900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9IO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,6-iodo-1,3-benzodioxol-5-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9IO5 |
|---|---|
| Molecular Weight | 324.06900 |
| Exact Mass | 323.94900 |
| PSA | 75.99000 |
| LogP | 1.81640 |
| InChIKey | SZGAYZRUKWZVST-UHFFFAOYSA-N |
| SMILES | CC(=O)O.Oc1cc2c(cc1I)OCO2 |
|
~70%
acetic acid,6-i... CAS#:67467-12-3 |
| Literature: Pirrung; Fallon; Zhu; Yong Rok Lee Journal of the American Chemical Society, 2001 , vol. 123, # 16 p. 3638 - 3643 |
|
~%
acetic acid,6-i... CAS#:67467-12-3 |
| Literature: Pirrung; Fallon; Zhu; Yong Rok Lee Journal of the American Chemical Society, 2001 , vol. 123, # 16 p. 3638 - 3643 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Iod-4,5-methylendioxy-phenyl-acetat |
| 2-iodo-4,5-methylenedioxyphenyl acetate |
| 1,3-Benzodioxol-5-ol,6-iodo-,acetate |
| iodosesamol acetate |