2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one
2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one structure
|
Common Name | 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 67467-45-2 | Molecular Weight | 241.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,4-Dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one (CAS号：67467-45-2, molecular formula：C10H11NO6, molecular weight：241.19700) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11NO6 |
|---|---|
| Molecular Weight | 241.19700 |
| Exact Mass | 241.05900 |
| PSA | 88.46000 |
| LogP | 0.20180 |
| InChIKey | VVCAIBZWJDJGJQ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)N(O)C(=O)C(O)O2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dihydroxy-6... CAS#:67467-45-2 |
| Literature: Atkinson, Jeffrey; Morand, Peter; Arnason, John T.; Niemeyer, Hermann M.; Bravo, Hector R. Journal of Organic Chemistry, 1991 , vol. 56, # 5 p. 1788 - 1800 |
|
~%
2,4-dihydroxy-6... CAS#:67467-45-2 |
| Literature: Tays, Kevin; Atkinson, Jeffrey Synthetic Communications, 1998 , vol. 28, # 5 p. 903 - 912 |
|
~%
2,4-dihydroxy-6... CAS#:67467-45-2 |
| Literature: Atkinson, Jeffrey; Morand, Peter; Arnason, John T.; Niemeyer, Hermann M.; Bravo, Hector R. Journal of Organic Chemistry, 1991 , vol. 56, # 5 p. 1788 - 1800 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-dihydroxy-6,7-dimethoxy-2H-1,4-benzoxazin-3-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: LogP of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is 0.20180. |
| Q: What is the SMILES notation of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: SMILES notation of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is COc1cc2c(cc1OC)N(O)C(=O)C(O)O2. |
| Q: What is the Chinese name of 67467-45-2? |
| A: Chinese name of 67467-45-2 is 67467-45-2. |
| Q: What is the molecular weight of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: Molecular weight of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is 241.19700. |
| Q: What is the InChIKey of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: InChIKey of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is VVCAIBZWJDJGJQ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: Polar surface area (PSA) of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is 88.46000. |
| Q: What is the CAS number of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: CAS number of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is 67467-45-2. |
| Q: What is the English name of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: The English name of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one. |
| Q: What English synonyms does 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one have? |
| A: English synonyms of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one: 2,4-dihydroxy-6,7-dimethoxy-2H-1,4-benzoxazin-3-one. |
| Q: What is the molecular formula of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one? |
| A: Molecular formula of 2,4-dihydroxy-6,7-dimethoxy-1,4-benzoxazin-3-one is C10H11NO6. |