1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate
Modify Date: 2026-07-16 11:01:59
1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate structure
|
Common Name | 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 674792-00-8 | Molecular Weight | 332.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H32N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H32N2O2 |
|---|---|
| Molecular Weight | 332.5 |
| InChIKey | MLYJCHYYPVIGHW-SFHVURJKSA-N |
| SMILES | CC(C)CC1CN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate? |
| A: InChIKey of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate is MLYJCHYYPVIGHW-SFHVURJKSA-N. |
| Q: What is the English name of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate? |
| A: The English name of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate is 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate. |
| Q: What is the CAS number of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate? |
| A: CAS number of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate is 674792-00-8. |
| Q: What is the Chinese name of 674792-00-8? |
| A: Chinese name of 674792-00-8 is 674792-00-8. |
| Q: What is the SMILES notation of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate? |
| A: SMILES notation of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate is CC(C)CC1CN(Cc2ccccc2)CCN1C(=O)OC(C)(C)C. |
| Q: What is the molecular weight of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate? |
| A: Molecular weight of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate is 332.5. |
| Q: What is the molecular formula of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate? |
| A: Molecular formula of 1,1-Dimethylethyl (2S)-2-(2-methylpropyl)-4-(phenylmethyl)-1-piperazinecarboxylate is C20H32N2O2. |