4-(6-methylnaphthalen-2-yl)but-3-en-2-one
4-(6-methylnaphthalen-2-yl)but-3-en-2-one structure
|
Common Name | 4-(6-methylnaphthalen-2-yl)but-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 67503-57-5 | Molecular Weight | 210.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(6-methylnaphthalen-2-yl)but-3-en-2-one, Chinese name: 4-(6-甲基萘-2-基)丁-3-烯-2-酮, CAS number: 67503-57-5, molecular formula: C15H14O, molecular weight: 210.27100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(6-methylnaphthalen-2-yl)but-3-en-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O |
|---|---|
| Molecular Weight | 210.27100 |
| Exact Mass | 210.10400 |
| PSA | 17.07000 |
| LogP | 3.75040 |
| InChIKey | AOMBMXCBVFHVGR-SNAWJCMRSA-N |
| SMILES | CC(=O)C=Cc1ccc2cc(C)ccc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(6-methylnaph... CAS#:67503-57-5 |
| Literature: Goudie,A.C. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, # 12 p. 1260 - 1264 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiinflammatory activity in Wistar rat assessed as inhibition of cotton pellet-induc...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3285897
|
|
Name: Antiinflammatory activity in Wistar rat assessed as inhibition of cotton pellet-induc...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3285901
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: LogP of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is 3.75040. |
| Q: What is the SMILES notation of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: SMILES notation of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is CC(=O)C=Cc1ccc2cc(C)ccc2c1. |
| Q: What are the upstream materials of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: Related upstream materials(CAS) of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one: 5084-46-8;67-64-1. |
| Q: What is the Chinese name of 67503-57-5? |
| A: Chinese name of 67503-57-5 is 67503-57-5. |
| Q: What is the polar surface area (PSA) of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: Polar surface area (PSA) of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is 17.07000. |
| Q: What is the English name of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: The English name of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is 4-(6-methylnaphthalen-2-yl)but-3-en-2-one. |
| Q: What is the molecular formula of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: Molecular formula of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is C15H14O. |
| Q: What is the InChIKey of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: InChIKey of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is AOMBMXCBVFHVGR-SNAWJCMRSA-N. |
| Q: What is the CAS number of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: CAS number of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is 67503-57-5. |
| Q: What is the molecular weight of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one? |
| A: Molecular weight of 4-(6-methylnaphthalen-2-yl)but-3-en-2-one is 210.27100. |