N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide
![N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide Structure](https://image.chemsrc.com/caspic/169/67519-72-6.png)
N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide structure
|
Common Name | N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 67519-72-6 | Molecular Weight | 241.78900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-[(Dimethyl(dimethylsilyl) methyl]-N-phenylacetamide (CAS: 67519-72-6, molecular formula: C11H16ClNOSi, molecular weight: 241.78900) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16ClNOSi |
|---|---|
| Molecular Weight | 241.78900 |
| Exact Mass | 241.06900 |
| PSA | 20.31000 |
| LogP | 3.44090 |
| InChIKey | JXKZRFXIIXOKMN-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C[Si](C)(C)Cl)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~77%
N-[[chloro(dime... CAS#:67519-72-6 |
| Literature: Shipov, A.G.; Kramarova, E.P.; Baukov, Yu. I. Russian Journal of General Chemistry, 1994 , vol. 64, # 7.2 p. 1099 - 1100 Zhurnal Obshchei Khimii, 1994 , vol. 64, # 7 p. 1220 - 1221 |
|
~%
N-[[chloro(dime... CAS#:67519-72-6 |
| Literature: Hillyard,R.W. et al. Journal of Organometallic Chemistry, 1978 , vol. 153, p. 369 - 377 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Chlor-dimethylsilylmethyl-acetanilid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: SMILES notation of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is CC(=O)N(C[Si](C)(C)Cl)c1ccccc1. |
| Q: What is the English name of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: The English name of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide. |
| Q: What are the upstream materials of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: Related upstream materials(CAS) of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide: 1719-57-9;103-84-4;10557-63-8. |
| Q: What is the LogP of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: LogP of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is 3.44090. |
| Q: What is the molecular formula of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: Molecular formula of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is C11H16ClNOSi. |
| Q: What is the Chinese name of 67519-72-6? |
| A: Chinese name of 67519-72-6 is 67519-72-6. |
| Q: What is the InChIKey of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: InChIKey of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is JXKZRFXIIXOKMN-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: Polar surface area (PSA) of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is 20.31000. |
| Q: What is the molecular weight of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: Molecular weight of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is 241.78900. |
| Q: What is the CAS number of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide? |
| A: CAS number of N-[[chloro(dimethyl)silyl]methyl]-N-phenylacetamide is 67519-72-6. |