2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(1-methylethenyl)-5-(2-methylpropyl)-
Modify Date: 2025-10-06 18:34:46
2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(1-methylethenyl)-5-(2-methylpropyl)- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(1-methylethenyl)-5-(2-methylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 67526-24-3 | Molecular Weight | 224.25600 | |
| Density | 1.105g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-methylpropyl)-5-prop-1-en-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Exact Mass | 224.11600 |
| PSA | 75.27000 |
| LogP | 1.61860 |
| Index of Refraction | 1.477 |
| InChIKey | MTNRLILTBTZHQJ-UHFFFAOYSA-N |
| SMILES | C=C(C)C1(CC(C)C)C(=O)NC(=O)NC1=O |
|
~%
2,4,6(1H,3H,5H)... CAS#:67526-24-3 |
| Literature: Cope; Hancock Journal of the American Chemical Society, 1939 , vol. 61, p. 96 |
| 5-isobutyl-5-isopropenyl-barbituric acid |
| 5-Isobutyl-5-isopropenyl-barbitursaeure |