L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI)
Modify Date: 2025-09-16 09:22:56
![L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) Structure](https://www.chemsrc.com/extcaspic/007/676129-91-2.png)
L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) structure
|
Common Name | L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 676129-91-2 | Molecular Weight | 349.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19N5O2 |
|---|---|
| Molecular Weight | 349.4 |
| InChIKey | XSHSVBJLNJNRJC-KRWDZBQOSA-N |
| SMILES | CC(C)C(N=Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI)? |
| A: Molecular weight of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) is 349.4. |
| Q: What is the molecular formula of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI)? |
| A: Molecular formula of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) is C19H19N5O2. |
| Q: What is the SMILES notation of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI)? |
| A: SMILES notation of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) is CC(C)C(N=Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)O. |
| Q: What is the Chinese name of 676129-91-2? |
| A: Chinese name of 676129-91-2 is 676129-91-2. |
| Q: What is the CAS number of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI)? |
| A: CAS number of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) is 676129-91-2. |
| Q: What is the InChIKey of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI)? |
| A: InChIKey of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) is XSHSVBJLNJNRJC-KRWDZBQOSA-N. |
| Q: What is the English name of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI)? |
| A: The English name of L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI) is L-Valine, N-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methylene]-(9CI). |