1,2,3,4-tetrachloro-5-methyl-6-nitrobenzene structure
|
Common Name | 1,2,3,4-tetrachloro-5-methyl-6-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 67627-20-7 | Molecular Weight | 274.91600 | |
| Density | 1.662g/cm3 | Boiling Point | 333.3ºC at 760 mmHg | |
| Molecular Formula | C7H3Cl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.4ºC | |
| Name | 1,2,3,4-tetrachloro-5-methyl-6-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.662g/cm3 |
|---|---|
| Boiling Point | 333.3ºC at 760 mmHg |
| Molecular Formula | C7H3Cl4NO2 |
| Molecular Weight | 274.91600 |
| Flash Point | 155.4ºC |
| Exact Mass | 272.89200 |
| PSA | 45.82000 |
| LogP | 5.04000 |
| Index of Refraction | 1.608 |
| InChIKey | ITWGFVBULTWHHD-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)c(Cl)c(Cl)c(Cl)c1[N+](=O)[O-] |
|
~%
1,2,3,4-tetrach... CAS#:67627-20-7 |
| Literature: Silberrad Journal of the Chemical Society, 1925 , vol. 127, p. 2681 |
|
~%
1,2,3,4-tetrach... CAS#:67627-20-7 |
| Literature: Silberrad Journal of the Chemical Society, 1925 , vol. 127, p. 2681 |
|
~%
1,2,3,4-tetrach... CAS#:67627-20-7 |
| Literature: Silberrad Journal of the Chemical Society, 1925 , vol. 127, p. 2681 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3,4,5-tetrachloro-6-nitro-toluene |
| 2,3,4,5-Tetrachlor-6-nitro-toluol |