1-(dipyridin-2-ylmethylideneamino)-3-phenylthiourea structure
|
Common Name | 1-(dipyridin-2-ylmethylideneamino)-3-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 67629-66-7 | Molecular Weight | 333.41000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(dipyridin-2-ylmethylideneamino)-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15N5S |
|---|---|
| Molecular Weight | 333.41000 |
| Exact Mass | 333.10500 |
| PSA | 101.33000 |
| LogP | 3.82700 |
| InChIKey | VNUVYYRRCULWPI-UHFFFAOYSA-N |
| SMILES | S=C(NN=C(c1ccccn1)c1ccccn1)Nc1ccccc1 |
|
~69%
1-(dipyridin-2-... CAS#:67629-66-7 |
| Literature: Richardson, Des R.; Sharpe, Philip C.; Lovejoy, David B.; Senaratne, Dakshita; Kalinowski, Danuta S.; Islam, Mohammad; Bernhardt, Paul V. Journal of Medicinal Chemistry, 2006 , vol. 49, # 22 p. 6510 - 6521 |
|
~%
1-(dipyridin-2-... CAS#:67629-66-7 |
| Literature: Suni; Prathapachandra Kurup; Nethaji, Munirathinam Spectrochimica Acta - Part A: Molecular and Biomolecular Spectroscopy, 2006 , vol. 63, # 1 p. 174 - 181 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| di-2-pyridylketone-4-phenyl-3-thiosemicarbazone |
| Hdpkptsc |