1,2-O-Cyclohexylidene-myo-inositol structure
|
Common Name | 1,2-O-Cyclohexylidene-myo-inositol | ||
|---|---|---|---|---|
| CAS Number | 6763-47-9 | Molecular Weight | 260.28400 | |
| Density | 1.47g/cm3 | Boiling Point | 466.446ºC at 760 mmHg | |
| Molecular Formula | C12H20O6 | Melting Point | 176-178ºC | |
| MSDS | N/A | Flash Point | 235.898ºC | |
| Name | 1,2-O-Cyclohexylidene-myo-inositol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 466.446ºC at 760 mmHg |
| Melting Point | 176-178ºC |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.28400 |
| Flash Point | 235.898ºC |
| Exact Mass | 260.12600 |
| PSA | 99.38000 |
| Index of Refraction | 1.605 |
| InChIKey | SOONKKMMJCQOLI-ZBJKAAEASA-N |
| SMILES | OC1C(O)C(O)C2OC3(CCCCC3)OC2C1O |
|
~97%
1,2-O-Cyclohexy... CAS#:6763-47-9 |
| Literature: Morisaki, Kazuo; Ozaki, Shoichiro Carbohydrate Research, 1996 , vol. 286, p. 123 - 138 |
|
~82%
1,2-O-Cyclohexy... CAS#:6763-47-9 |
| Literature: Vibhute, Amol M.; Sureshan, Kana M. RSC Advances, 2013 , vol. 3, # 20 p. 7321 - 7329 |
|
~80%
1,2-O-Cyclohexy... CAS#:6763-47-9 |
| Literature: Garegg, Per J.; Lindberg, Bengt; Kvarnstroem, Ingemar; Svensson, Stefan C. T. Carbohydrate Research, 1988 , vol. 173, p. 205 - 216 |
|
~%
1,2-O-Cyclohexy... CAS#:6763-47-9 |
| Literature: Tetrahedron Letters, , vol. 36, # 12 p. 2125 - 2128 |
|
~%
1,2-O-Cyclohexy... CAS#:6763-47-9 |
| Literature: Carbohydrate Research, , vol. 282, # 1 p. 81 - 99 |
|
~%
1,2-O-Cyclohexy... CAS#:6763-47-9 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 6 p. 729 - 738 |
| (R,R)-Diphenylbis-[(o-anisyl)-methylenephosphine] |
| 1,2-bis[(o-methoxyphenyl)phenylphosphino]ethane |
| (R,R)-1,2-Bis[(o-methoxyphenyl)phenylphosphino]ethane |
| (+/-)-1,2-O-cyclohexylidene-myo-inositol |
| Ethylenebis(2-methoxyphenylphenylphosphine) |
| (+/-)-1,2-ethandiylbis[(o-anisylphenyl)phenyl]phosphine |
| Ethylenebis[phenyl(2-methoxyphenyl)phosphine] |
| (1R,2R)-BIS[(2-METHOXYPHENYL)PHENYLPHOSPHINO]ETHANE |
| rac-1,2-O-cyclohexylidene-myo-inositol |
| (R,R)-ETHYLENEBIS[(2-METHOXYPHENYL)PHENYLPHOSPHINE] |
| (-)-DIPAMP |
| DL-1,2-O-cyclohexylidene-myo-inositol |
| 1,2-bis[(2-methoxyphenyl)(phenyl)phosphino]ethane |
| 1,2-ethanediylbis[(o-anisylphenyl)phenylphosphine] |
| 1,2-O-cyclohexylidene-D/L-myo-inositol |