2-iodo-1-(3-methyl-2-methylidene-1,4,5,9-tetrazabicyclo[4.3.0]nona-3,5,7-trien-9-yl)ethanone structure
|
Common Name | 2-iodo-1-(3-methyl-2-methylidene-1,4,5,9-tetrazabicyclo[4.3.0]nona-3,5,7-trien-9-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6763-71-9 | Molecular Weight | 316.09800 | |
| Density | 1.91g/cm3 | Boiling Point | 355.2ºC at 760 mmHg | |
| Molecular Formula | C9H9IN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.6ºC | |
| Name | 2-iodo-1-(3-methyl-4-methylidenepyrazolo[5,1-c][1,2,4]triazin-6-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.91g/cm3 |
|---|---|
| Boiling Point | 355.2ºC at 760 mmHg |
| Molecular Formula | C9H9IN4O |
| Molecular Weight | 316.09800 |
| Flash Point | 168.6ºC |
| Exact Mass | 315.98200 |
| PSA | 52.19000 |
| LogP | 0.60580 |
| Index of Refraction | 1.735 |
| InChIKey | DPSQSBQBWHFTRX-UHFFFAOYSA-N |
| SMILES | C=C1C(C)=NN=C2C=CN(C(=O)CI)N12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Jodacetyl-3-methyl-4-methylen-pyrazolo<3,2-c>-as-triazin |
| 6-Iodacetyl-3-methyl-4-methylenpyrazolo<3,2-c>-as-triazin |